ALPK1-IN-3 [CAS 2765633-73-4]
Partner: MedChemexpress LLC
CAS No: | 2765633-73-4 |
Applications: | COVID-19-immunoregulation |
MW: | 398.43 |
Formula: | C20H16F2N4OS |
SMILES: | O=C(C1=C(C=C(N2CCNCC2)C=C1F)F)NC3=NC4=C(S3)C=CC=C4C#C |
Purity: | 98.36 |
Description: | ALPK1-IN-3 is an inhibitor of ALPK1 extracted from patent WO2022063153A1 compound T007. ALPK1-IN-3 inhibits kidney proinflammatory gene expression and improves the survival rate of the animals in sepsis induced acute kidney injury animal model[1]. ALPK1-IN-3 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. |
Shipping Conditions: | Ship at ambient |
Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice