Myosin V-IN-1 [CAS 1259177-59-7]
Partner: MedChemexpress LLC
| CAS No: | 1259177-59-7 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 538.62 |
| Formula: | C29H26N6O3S |
| SMILES: | O=C(C1=CC(SCC2=CC(NC3=NC(NN=C4C5=CC=C(N6CCOCC6)C=C5)=C4C=N3)=CC=C2)=CC=C1)O |
| Purity: | 97.49 |
| Description: | Myosin V-IN-1 (compound 8) is a potent and selective Myosin V inhibitor, with a Ki of 6 ?M. Myosin V-IN-1 shows acute inhibition of myosin V. Myosin V-IN-1 slows the actin-activated myosin V ATPase by specifically inhibiting ADP release from the actomyosin complex[1][2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
