Nelfinavir [CAS 159989-64-7]
Partner: MedChemexpress LLC
| CAS No: | 159989-64-7 |
| Applications: | COVID-19-anti-virus |
| MW: | 567.78 |
| Formula: | C32H45N3O4S |
| SMILES: | [H][C@]12C[C@@H](C(NC(C)(C)C)=O)N(C[C@H]([C@@H](NC(C3=C(C)C(O)=CC=C3)=O)CSC4=CC=CC=C4)O)C[C@@]1([H])CCCC2 |
| Purity: | 98.83 |
| Description: | Nelfinavir (AG-1341) is a potent and orally bioavailable HIV-1 protease inhibitor (Ki=2 nM) for HIV infection. Nelfinavir is a broad-spectrum, anticancer agent[1][2][3]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
