Zosuquidar [CAS 167354-41-8]
Partner: MedChemexpress LLC
| CAS No: | 167354-41-8 |
| Applications: | Cancer-programmed cell death |
| MW: | 527.60 |
| Formula: | C32H31F2N3O2 |
| SMILES: | FC1([C@H]2[C@@H]1C3=C([C@@H](C4=CC=CC=C42)N5CCN(CC5)C[C@H](COC6=C7C=CC=NC7=CC=C6)O)C=CC=C3)F |
| Purity: | 98.33 |
| Description: | Zosuquidar (LY335979) is a P-glycoprotein (P-gp) inhibitor (Ki=59 nM). Zosuquidar shows anti-tumor activities, and can be used in acute myelogenous leukemia (AML) research[1][2][3]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
