TBK1-IN-1
Partner: MedChemexpress LLC
| Applications: | Cancer-Kinase/protease |
| MW: | 489.61 |
| Formula: | C27H35N7O2 |
| SMILES: | CC(N1CCN(CC1)CC2=CC=CC(NC3=NC=C4C=CN(C4=N3)CCCNC(C5CCC5)=O)=C2)=O |
| Purity: | 98.71 |
| Description: | TBK1-IN-1 is a potent and selective TANK binding kinase 1 (TBK1) inhibitor with an IC50 value of 22.4 nM. TBK1-IN-1 inhibits TBK1 downstream target genes cxcl10 and ifnβ expression. TBK1-IN-1 has anticancer activity[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
