Anti-inflammatory agent 32 [CAS 2577388-38-4]
Partner: MedChemexpress LLC
| CAS No: | 2577388-38-4 |
| Applications: | COVID-19-immunoregulation |
| MW: | 324.37 |
| Formula: | C20H20O4 |
| SMILES: | OC(C=C1/C=C/C(C2=CC(C/C=C(C)\C)=C(C=C2)O)=O)=C(C=C1)O |
| Purity: | 99.52 |
| Description: | Anti-inflammatory agent 32 (compound C3) has anti-oxidative and anti-inflammatory activity. Anti-inflammatory agent 32 can be used for skin care products research and development[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
