Firategrast [CAS 402567-16-2]
Partner: MedChemexpress LLC
| CAS No: | 402567-16-2 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 499.50 |
| Formula: | C27H27F2NO6 |
| SMILES: | O=C(O)[C@@H](NC(C1=C(F)C=CC=C1F)=O)CC2=CC=C(C3=C(OC)C=C(COCC)C=C3OC)C=C2 |
| Purity: | 99.62 |
| Description: | Firategrast (SB 683699) is an orally active and specific ?4?1/?4?7 integrin antagonist. Firategrast reduces trafficking of lymphocytes into the central nervous system (CNS) and decreases multiple sclerosis (MS) activity[1][2][3]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
