Mc-Val-Cit-PAB-Gefitinib (chloride)
Partner: MedChemexpress LLC
| Applications: | Cancer-Kinase/protease |
| MW: | 1038.00 |
| Formula: | C50H63Cl2FN10O9 |
| SMILES: | COC1=CC2=C(C=C1OCCCN3CCOCC3)C(NC(C=C4)=CC(Cl)=C4F)=NC=[N+]2CC(C=C5)=CC=C5NC([C@H](CCCNC(N)=O)NC([C@H](C(C)C)NC(CCCCCN(C6=O)C(C=C6)=O)=O)=O)=O.[Cl-] |
| Purity: | 98.69 |
| Description: | Mc-Val-Cit-PAB-Gefitinib chloride is a agent-linker conjugates for ADC. Mc-Val-Cit-PAB-Gefitinib chloride consists of Gefitinib (HY-50895) (an EGFR tyrosine kinase inhibitor) and the ADC linker Mc-Val-Cit-PAB[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
