Maytansinoid B [CAS 1628543-40-7]
Partner: MedChemexpress LLC
| CAS No: | 1628543-40-7 |
| Applications: | Cancer-programmed cell death |
| MW: | 735.26 |
| Formula: | C36H51ClN4O10 |
| SMILES: | O=C(N(C)[C@@H](C)C(O[C@H]([C@@]1(C)[C@@H](O1)[C@@H]2C)CC(N(C)C3=C(Cl)C(OC)=CC(C/C(C)=C/C=C/[C@@H](OC)[C@]4(O)NC(O[C@H]2C4)=O)=C3)=O)=O)CCNC |
| Purity: | 99.06 |
| Description: | Maytansinoid B is a kind of ADC Cytotoxin. Maytansinoid B can be used to conjugates with antibodies to form antibody-drug conjugates (ADCs). Maytansinoids are known as antimitotic agents, binding to tubulin and inhibiting microtubule assembly. Maytansinoids induces G2/M arrest in the cell cycle to induce apoptosis[1][2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
