Avibactam (free acid) [CAS 1192500-31-4]
Partner: MedChemexpress LLC
| CAS No: | 1192500-31-4 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 265.24 |
| Formula: | C7H11N3O6S |
| SMILES: | O=S(ON1[C@]2([H])CC[C@@H](C(N)=O)[N@@](C2)C1=O)(O)=O |
| Purity: | 99.22 |
| Description: | Avibactam (NXL-104) free acid is a covalent and reversible non-?-lactam ?-lactamase inhibitor which inhibits ?-lactamase TEM-1 and CTX-M-15 with IC50s of 8 nM and 5 nM, respectively[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
