YX-2-107 [CAS 2417408-46-7]
Partner: MedChemexpress LLC
| CAS No: | 2417408-46-7 |
| Applications: | Cancer-Kinase/protease |
| MW: | 889.95 |
| Formula: | C45H51N11O9 |
| SMILES: | O=C1NC(C(CC1)N2C(C3=C(C2=O)C(OCC(NCCCCNCC(N4CCN(CC4)C5=CN=C(NC6=NC(N(C7CCCC7)C(C(C(C)=O)=C8C)=O)=C8C=N6)C=C5)=O)=O)=CC=C3)=O)=O |
| Purity: | 99.79 |
| Description: | YX-2-107 is a PROTAC (IC50= 4.4 nM) that selectively degrades CDK6. YX-2-107 effectively inhibits RB phosphorylation and FOXM1 expression in vitro and inhibits the development of Ph+ ALL in rats. YX-2-107 can be used in the study of Ph chromosome-positive (Ph+) acute lymphoblastic leukemia (ALL)[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
