IRG1-IN-1 [CAS 2407652-42-8] (10mM in DMSO)
Partner: MedChemexpress LLC
| CAS No: | 2407652-42-8 |
| Applications: | COVID-19-immunoregulation |
| MW: | 314.31 |
| Formula: | C18H15FO4 |
| SMILES: | O=C(O)/C(C(CC1=CC=CC=C1)C(O)=O)=C\C2=CC=C(F)C=C2 |
| Purity: | 99.82 |
| Description: | IRG1-IN-1 is an itaconic acid derivative. IRG1-IN-1 can inhibit immune-responsive gene 1 (IRG1) activity. IRG1-IN-1 can be used for the research of cancer, inflammation and autoimmune diseases[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
