Adarotene [CAS 496868-77-0] (10mM in DMSO)
Partner: MedChemexpress LLC
| CAS No: | 496868-77-0 |
| Applications: | Cancer-programmed cell death |
| MW: | 374.47 |
| Formula: | C25H26O3 |
| SMILES: | O=C(O)/C=C/C1=CC=C(C2=CC=C(O)C(C3(C4)CC5CC4CC(C5)C3)=C2)C=C1 |
| Purity: | 99.18 |
| Description: | Adarotene is an effective apoptosis inducer, which surprisingly produces DNA damage and exhibites a potent antiproliferative activity on a large panel of human tumor cells. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
