Vipoglanstat [CAS 1360622-01-0]
Partner: MedChemexpress LLC
| CAS No: | 1360622-01-0 |
| Applications: | COVID-19-immunoregulation |
| MW: | 678.52 |
| Formula: | C30H34Cl2F5N5O3 |
| SMILES: | CN1C2=CC(OCC(F)F)=C(C(N[C@@H]3CC[C@H](CC3)C(F)(F)F)=O)C=C2N=C1NC4=C(C(CNC(C(C)(C)C)=O)=CC=C4Cl)Cl |
| Purity: | 99.74 |
| Description: | Vipoglanstat (BI 1029539), a carboxamide, is a potent and selective, non-peptide and orally active small molecular inhibitor of human prostaglandin E synthase 1 (mPGES-1). Vipoglanstat also has anti-inflammatory activity[1][2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
