Choline Fenofibrate [CAS 856676-23-8]
Partner: MedChemexpress LLC
| CAS No: | 856676-23-8 |
| Applications: | COVID-19-anti-virus |
| MW: | 421.91 |
| Formula: | C22H28ClNO5 |
| SMILES: | O=C(C1=CC=C(OC(C)(C([O-])=O)C)C=C1)C2=CC=C(Cl)C=C2.C[N+](C)(CCO)C |
| Purity: | 99.86 |
| Description: | Choline Fenofibrate (ABT-335), a choline salt of Fenofibric acid (HY-B0760), releases free Fenofibric acid in the gastrointestinal tract. Fenofibric acid is a PPAR activator with antihyperlipidemic effect[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
