Biocytin hydrazide [CAS 102743-85-1]
Partner: MedChemexpress LLC
| CAS No: | 102743-85-1 |
| Applications: | Metabolism-protein/nucleotide metabolism |
| MW: | 386.51 |
| Formula: | C16H30N6O3S |
| SMILES: | NNC([C@@H](N)CCCCNC(CCCC[C@H]1[C@]2([H])[C@](NC(N2)=O)([H])CS1)=O)=O |
| Purity: | 96.0 |
| Description: | Biocytin hydrazide is a selective label for sialic acids, galactose, and other sugars in glycoconjugates using avidin-biotin technology[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
