VT02956 [CAS 2999763-09-4]
Partner: MedChemexpress LLC
| CAS No: | 2999763-09-4 |
| Applications: | Cancer-Kinase/protease |
| MW: | 373.45 |
| Formula: | C22H23N5O |
| SMILES: | NCC1CCN(CC1)C2=NC(C3=CC=NC=C3)=NC4=C2C=CC=C4C#CCO |
| Purity: | 99.58 |
| Description: | VT02956 is a LATS inhibitor (IC50: 0.76 nM for LATS1, 0.52 nM for LATS2). VT02956 targets the Hippo pathway. VT02956 inhibits ESR1 expression and growth of ER+ breast cancer cell lines and patient-derived tumor organoids[1]. VT02956 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
