Soblidotin [CAS 149606-27-9]
Partner: MedChemexpress LLC
| CAS No: | 149606-27-9 |
| Applications: | Cancer-Kinase/protease |
| MW: | 701.98 |
| Formula: | C39H67N5O6 |
| SMILES: | O=C(N[C@@H](C(C)C)C(N([C@@H]([C@H](CC)C)[C@H](OC)CC(N1CCC[C@@]1([H])[C@H](OC)[C@@H](C)C(NCCC2=CC=CC=C2)=O)=O)C)=O)[C@H](C(C)C)N(C)C |
| Purity: | 99.64 |
| Description: | Soblidotin (Auristatin PE) is a novel synthetic Dolastatin 10 derivative and inhibitor of tubulin polymerization. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
