(+)-DHMEQ [CAS 287194-41-6]
Partner: MedChemexpress LLC
| CAS No: | 287194-41-6 |
| Applications: | COVID-19-immunoregulation |
| MW: | 261.23 |
| Formula: | C13H11NO5 |
| SMILES: | O=C(NC([C@@H](O)[C@@]1([H])O[C@@]21[H])=CC2=O)C3=CC=CC=C3O |
| Purity: | 99.33 |
| Description: | (+)-DHMEQ is an activator of antioxidant transcription factor Nrf2. (+)-DHMEQ is the enantiomer of (-)-DHMEQ. (-)-DHMEQ inhibits NF-kB than its enantiomer (+)-DHMEQ. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
