(-)-DHMEQ [CAS 287194-40-5]
Partner: MedChemexpress LLC
| CAS No: | 287194-40-5 |
| Applications: | Cancer-programmed cell death |
| MW: | 261.23 |
| Formula: | C13H11NO5 |
| SMILES: | O=C1[C@@H](O2)[C@@H]2[C@@H](O)C(NC(C3=C(O)C=CC=C3)=O)=C1 |
| Purity: | 98.72 |
| Description: | (-)-DHMEQ (Dehydroxymethylepoxyquinomicin) is a potent, selective and irreversible NF-?B inhibitor that covalently binds to a cysteine residue. (-)-DHMEQ inhibits nuclear translocation of NF-?B and shows anti-inflammatory and anticancer activity[1][2][3]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
