ATG7-IN-3 [CAS 2226229-76-9]
Partner: MedChemexpress LLC
| CAS No: | 2226229-76-9 |
| Applications: | COVID-19-immunoregulation |
| MW: | 376.41 |
| Formula: | C11H16N6O5S2 |
| SMILES: | CSC1=NN([C@]2([H])O[C@@H]([C@H](C2)O)COS(N)(=O)=O)C3=NC=NC(N)=C31 |
| Description: | ATG7-IN-3 (compound 18) is a potent ATG7 inhibitor, with an IC50 of 0.048 ?M. ATG7-IN-3 inhibits autophagy. ATG7-IN-3 inhibits the formation of endogenous LC3B puncta in the neuroglioma cell line H4[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
