ASR-488 [CAS 2690312-65-1]
Partner: MedChemexpress LLC
| CAS No: | 2690312-65-1 |
| MW: | 580.73 |
| Formula: | C33H40O7S |
| SMILES: | C[C@]([C@](CC[C@@]12C)([H])[C@@]([C@]1([H])CC[C@]2([H])[C@@H]([C@@](OC3=O)([H])CC(C)=C3CO)C)([H])C4)(C5=O)[C@@]6([C@H](C=C5)OC(C7=CC=CS7)=O)[C@]4([H])O6 |
| Purity: | 99.73 |
| Description: | ASR-488 activates the mRNA-binding protein CPEB1, induces apoptosis and inhibits bladder cancer growth[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
