NT219 [CAS 1198078-60-2]
Partner: MedChemexpress LLC
| CAS No: | 1198078-60-2 |
| Applications: | Cancer-Kinase/protease |
| MW: | 412.26 |
| Formula: | C16H14BrNO5S |
| SMILES: | OC(C=C1CNC(/C=C/C2=C(C(O)=C(C=C2)O)Br)=S)=C(C(O)=C1)O |
| Purity: | 98.57 |
| Description: | NT219 is a potent and dual inhibitor of insulin receptor substrates 1/2 (IRS1/2) and STAT3. IRS1/2 and STAT3 are major signaling junctions regulated by various oncogenes. NT219 affects IRS1/2 degradation and inhibits STAT3 phosphorylation. NT219 has the potential for the research of cancer diseases[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
