Narmafotinib [CAS 1393653-34-3]
Partner: MedChemexpress LLC
| CAS No: | 1393653-34-3 |
| Applications: | Cancer-Kinase/protease |
| MW: | 527.58 |
| Formula: | C28H32F3N5O2 |
| SMILES: | O=C(CC1=C(CCC2=NC(NC3=CC=C(C4CCN(CC4)C)C=C3OC)=NC=C2C(F)(F)F)C=CC=C1)N |
| Purity: | 98.96 |
| Description: | Narmafotinib (AMP-945) is an inhibitor of the enzyme focal adhesion kinase (FAK, KD=0.21 nM). Narmafotinib inhibits autophosphorylation of 397Y-FAK in MDA-MB-231 cells with an IC50=7 nM and exhibits low general cellular toxicity (IC50=2.7 ?M, MDA-MB-231 cells)[1][2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
