(4-NH2)-Exatecan [CAS 2495742-21-5]
Partner: MedChemexpress LLC
| CAS No: | 2495742-21-5 |
| Applications: | Cancer-programmed cell death |
| MW: | 403.43 |
| Formula: | C23H21N3O4 |
| SMILES: | O=C1N2C(C(C(C2)=C3C4=C5CCC3)=NC4=CC=C5N)=CC6=C1COC([C@]6(O)CC)=O |
| Purity: | 99.0 |
| Description: | (4-NH2)-Exatecan, a topoisomerase inhibitor, is a derivative of Exatecan. (4-NH2)-Exatecan can be used in the synthesis of antibody-drug conjugates (ADCs) (US20200306243A1, compound A)[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
