K 01-162 [CAS 677746-25-7]
Partner: MedChemexpress LLC
| CAS No: | 677746-25-7 |
| Applications: | Neuroscience-Neurodegeneration |
| MW: | 288.18 |
| Formula: | C15H14BrN |
| SMILES: | BrC1=CC(CC2=C3C=CC(N(C)C)=C2)=C3C=C1 |
| Purity: | 98.0 |
| Description: | K 01-162 (K162) inhibits the fibril formation of A? peptides and eliminates their neurotoxicity. K 01-162 binds with A?42 peptide with an EC50 value of 80 nM. K 01-162 binds directly to A?O with a KD value of 19 ?M. K 01-162 is capable of penetrating the brain and can be used for the research of Alzheimer�s disease[1][2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
