MPO-IN-3 [CAS 1435469-45-6]
Partner: MedChemexpress LLC
| CAS No: | 1435469-45-6 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 371.88 |
| Formula: | C16H22ClN3O3S |
| SMILES: | O=C1C=C(N(CCCCN)C(N1)=S)C2=C(OC)C=C(OC)C=C2.Cl |
| Purity: | 99.73 |
| Description: | MPO-IN-3 is a potent myeloperoxidase (MPO) inhibitor (WO2013068875A1, example 191). Myeloperoxidase (MPO) is a heme-containing enzyme belonging to the peroxidase superfamily[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
