SB-216 [CAS 2756818-39-8]
Partner: MedChemexpress LLC
| CAS No: | 2756818-39-8 |
| Applications: | Cancer-programmed cell death |
| MW: | 310.35 |
| Formula: | C17H18N4O2 |
| SMILES: | O=C1NC2=C(C=CC(OC)=C2)N(C3=C(CCC4)C4=NC(C)=N3)C1 |
| Purity: | 99.93 |
| Description: | SB-216 is a potent tubulin polymerization inhibitor. SB-216 shows strong antiproliferative potency in a panel of human cancer cell lines, including melanoma, lung cancer, and breast cancer.� SB-216 can be used for cancer research[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
