AVJ16 [CAS 2775241-92-2]
Partner: MedChemexpress LLC
| CAS No: | 2775241-92-2 |
| Applications: | Cancer-Kinase/protease |
| MW: | 469.53 |
| Formula: | C28H27N3O4 |
| SMILES: | O=C(N1CCN(CC1)C2=CC3=C(OCO3)C=C2)C4=CC=C(C=C4)CN5C(CO)=CC6=C5C=CC=C6 |
| Purity: | 99.67 |
| Description: | AVJ16 is a cancer cell migration inhibitor that targets the insulin-like growth factor 2 mRNA binding protein IGF2BP1 to inhibit the migration of H1299 cells with high endogenous IGF2BP1 expression. AVJ16 interferes with IGF2BP1 binding target mRNA to regulate gene expression and translation[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
