NAT [CAS 831243-31-3]
Partner: MedChemexpress LLC
| CAS No: | 831243-31-3 |
| Applications: | Neuroscience-Neurodegeneration |
| MW: | 299.36 |
| Formula: | C18H21NO3 |
| SMILES: | CC(C)(C1=C(C=CC=C1)OCC(NC2=CC=C(C=C2)O)=O)C |
| Purity: | 99.56 |
| Description: | NAT is an initial hit of NAMPT activator. NAMPT is the rate-limiting enzyme in the NAD salvage pathway, which makes it an attractive target for the research of many diseases associated with NAD exhaustion such as neurodegenerative diseases[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
