NF-Kappa B-IN-4
Partner: MedChemexpress LLC
| Applications: | COVID-19-immunoregulation |
| MW: | 322.34 |
| Formula: | C18H15FN4O |
| SMILES: | COC1=CC(C2=C3CCC4=C(C3=NC(N)=N2)C=C(C=C4)F)=CN=C1 |
| Purity: | 99.66 |
| Description: | NF-?B-IN-4 (compound 17) is a potent and BBB-penetrated NF-?B pathway inhibitor with blood brain barrier (BBB) permeability. NF-?B-IN-4 exhibits potential anti-neuroinflammatory activity with low toxicity. NF-?B-IN-4 can block the activation and phosphorylation of I?B?, reduce expression of NLRP3, and thus inhibit NF-?B activation. NF-?B-IN-4 can be used for neuroinflammation related diseases research[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
