GPX4-IN-3 [CAS 2761004-85-5]
Partner: MedChemexpress LLC
| CAS No: | 2761004-85-5 |
| Applications: | Cancer-programmed cell death |
| MW: | 530.04 |
| Formula: | C29H24ClN3O3S |
| SMILES: | O=C(C(C1=CSC2=CC=CC=C21)N(C3=CC=C(C=C3)C4=CN=CO4)C(CCl)=O)NCCC5=CC=CC=C5 |
| Purity: | 99.90 |
| Description: | GPX4-IN-3 (26a) is a potent glutathione peroxidase 4 (GPX4) inhibitor as a selective ferroptosis inducer. GPX4-IN-3 (26a) exhibits 71.7% inhibition for GPX4 with 1 ?M[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
