SW2_110A
Partner: MedChemexpress LLC
| Applications: | Cancer-programmed cell death |
| MW: | 760.96 |
| Formula: | C42H60N6O7 |
| SMILES: | O=C(C1=CC=C(C=C1)OC2=CC=CC=C2)N[C@H](C(N[C@@H](C(N[C@H](C(N[C@H](C(NCC#C)=O)CO)=O)CCCCN(CC)CC)=O)[C@H](CC)C)=O)C3CCCC3 |
| Purity: | 99.16 |
| Description: | SW2_110A is a selective chromobox 8 chromodomain (CBX8 ChD) inhibitor with a Kd of 800 nM. SW2_110A shows minimal 5-fold selectivity for CBX8 ChD over all other CBX paralogs in vitro[1]. SW2_110A is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
