1,2-Dioleoyl-sn-glycero-3-phospho-L-serine (sodium) [CAS 90693-88-2]
Partner: MedChemexpress LLC
| CAS No: | 90693-88-2 |
| MW: | 810.03 |
| Formula: | C42H77NNaO10P |
| SMILES: | O=C(O[Na])[C@@H](N)COP(OC[C@@H](COC(CCCCCCC/C=C\CCCCCCCC)=O)OC(CCCCCCC/C=C\CCCCCCCC)=O)(O)=O |
| Purity: | 98.0 |
| Description: | 1,2-Dioleoyl-sn-glycero-3-phospho-L-serine sodium is a ubstitute for Phosphoserine/phosphatidylserine. 1,2-Dioleoyl-sn-glycero-3-phospho-L-serine sodium can be used in lipid mixtures with DOPC and DOPE as effective nontoxic and nonviral DNA vectors[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
