TAMRA-Azide-PEG-biotin [CAS 1797415-74-7]
Partner: MedChemexpress LLC
| CAS No: | 1797415-74-7 |
| Applications: | Cancer-programmed cell death |
| MW: | 1174.38 |
| Formula: | C57H79N11O14S |
| SMILES: | CN(C)C1=CC([O+]=C(C=C(N(C)C)C=C2)C2=C3C4=CC=C(C(NCCC(N(CCC(NCCOCCOCCOCCNC(CCCCC5SC(NC(N6)=O)C6C5)=O)=O)CCOCCOCCOCCN=[N+]=[N-])=O)=O)C=C4C([O-])=O)=C3C=C1.CN(C)C7=CC([O+]=C(C=C(N(C)C)C=C8)C8=C9C%10=CC(C(NCCC(N(CCC(NCCOCCOCCOCCNC(CCCCC%11SC(NC(N%12)=O)C%12C%11)=O)=O)CCOCCOCCOCCN=[N+]=[N-])=O)=O)=CC=C%10C([O-])=O)=C9C=C7 |
| Purity: | 99.0 |
| Description: | TAMRA-Azide-PEG-biotin is a dye derivative of TAMRA (HY-135640). TAMRA-Azide-PEG-biotin contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. Strain-promoted alkyne-azide cycloaddition (SPAAC) can also occur with molecules containing DBCO or BCN groups. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
