m-PEG12-azide [CAS 2170098-29-8]
Partner: MedChemexpress LLC
| CAS No: | 2170098-29-8 |
| Applications: | Cancer-programmed cell death |
| MW: | 585.69 |
| Formula: | C25H51N3O12 |
| SMILES: | COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-] |
| Description: | m-PEG12-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. m-PEG12-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. Strain-promoted alkyne-azide cycloaddition (SPAAC) can also occur with molecules containing DBCO or BCN groups. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
