N-(Azido-PEG2)-N-Boc-PEG3-NHS ester [CAS 2093153-85-4]
Partner: MedChemexpress LLC
| CAS No: | 2093153-85-4 |
| Applications: | Cancer-programmed cell death |
| MW: | 575.61 |
| Formula: | C24H41N5O11 |
| SMILES: | O=C(OC(C)(C)C)N(CCOCCOCCN=[N+]=[N-])CCOCCOCCOCCC(ON1C(CCC1=O)=O)=O |
| Purity: | 97.0 |
| Description: | N-(Azido-PEG2)-N-Boc-PEG3-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. N-(Azido-PEG2)-N-Boc-PEG3-NHS ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. Strain-promoted alkyne-azide cycloaddition (SPAAC) can also occur with molecules containing DBCO or BCN groups. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
