Azide-PEG2-Ms [CAS 176520-23-3]
Partner: MedChemexpress LLC
CAS No: | 176520-23-3 |
Applications: | Cancer-programmed cell death |
MW: | 209.22 |
Formula: | C5H11N3O4S |
SMILES: | [N-]=[N+]=NCCOCCOS(C)(=O)=O |
Purity: | 97.0 |
Description: | Azide-PEG2-Ms is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azide-PEG2-Ms is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. Strain-promoted alkyne-azide cycloaddition (SPAAC) can also occur with molecules containing DBCO or BCN groups. |
Shipping Conditions: | Ship at ambient |
Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice