PC Biotin-PEG3-NHS ester [CAS 2353409-93-3]
Partner: MedChemexpress LLC
| CAS No: | 2353409-93-3 |
| Applications: | Cancer-programmed cell death |
| MW: | 840.89 |
| Formula: | C36H52N6O15S |
| SMILES: | O=C(OC(C1=CC(OC)=C(OCCCC(NCCOCCOCCOCCNC(CCCC[C@@H]2SC[C@]([C@]2([H])N3)([H])NC3=O)=O)=O)C=C1[N+]([O-])=O)C)ON4C(CCC4=O)=O |
| Description: | PC Biotin-PEG3-NHS ester is a cleavable 3 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
