PC Biotin-PEG3-azide [CAS 1937270-46-6]
Partner: MedChemexpress LLC
| CAS No: | 1937270-46-6 |
| Applications: | Cancer-programmed cell death |
| MW: | 825.93 |
| Formula: | C35H55N9O12S |
| SMILES: | O=C(OC(C1=CC(OC)=C(OCCCC(NCCOCCOCCOCCNC(CCCC[C@H]2SC[C@@]([C@@]2([H])N3)([H])NC3=O)=O)=O)C=C1[N+]([O-])=O)C)NCCCN=[N+]=[N-] |
| Purity: | 99.25 |
| Description: | PC Biotin-PEG3-azide is a cleavable 3 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. PC Biotin-PEG3-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. Strain-promoted alkyne-azide cycloaddition (SPAAC) can also occur with molecules containing DBCO or BCN groups. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
