Azide-C2-SS-C2-biotin [CAS 1620523-64-9]
Partner: MedChemexpress LLC
| CAS No: | 1620523-64-9 |
| Applications: | Cancer-programmed cell death |
| MW: | 404.57 |
| Formula: | C14H24N6O2S3 |
| SMILES: | O=C(NCCSSCCN=[N+]=[N-])CCCC[C@@H]1SC[C@]([C@]1([H])N2)([H])NC2=O |
| Purity: | 98.79 |
| Description: | Azide-C2-SS-C2-biotin is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. Azide-C2-SS-C2-biotin is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. Strain-promoted alkyne-azide cycloaddition (SPAAC) can also occur with molecules containing DBCO or BCN groups. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
