N-(Aminooxy-PEG2)-N-bis(PEG3-propargyl) [CAS 2112737-71-8]
Partner: MedChemexpress LLC
| CAS No: | 2112737-71-8 |
| Applications: | Cancer-programmed cell death |
| MW: | 504.61 |
| Formula: | C24H44N2O9 |
| SMILES: | NOCCOCCOCCN(CCOCCOCCOCC#C)CCOCCOCCOCC#C |
| Purity: | 97.0 |
| Description: | N-(Aminooxy-PEG2)-N-bis(PEG3-propargyl) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. N-(Aminooxy-PEG2)-N-bis(PEG3-propargyl) is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
