Etavopivat [CAS 2245053-57-8]
Partner: MedChemexpress LLC
| CAS No: | 2245053-57-8 |
| Applications: | COVID-19-immunoregulation |
| MW: | 457.50 |
| Formula: | C22H23N3O6S |
| SMILES: | O=S(N1CC2=C(CN(C2)C([C@@H](C3=CC=CC=C3)CO)=O)C1)(C4=CN=C(OCCO5)C5=C4)=O |
| Purity: | 98.70 |
| Description: | Etavopivat is a potent, selective, orally bioavailable red blood cell (RBC) pyruvate kinase (PKR) activator. Etavopivat has potent antisickling effects[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
