MRTX849 acid [CAS 2561529-96-0]
Partner: MedChemexpress LLC
| CAS No: | 2561529-96-0 |
| Applications: | Cancer-Kinase/protease |
| MW: | 662.15 |
| Formula: | C34H37ClFN7O4 |
| SMILES: | OC(CCN(CCC1)[C@@H]1COC2=NC(N3C[C@@H](N(CC3)C(C(F)=C)=O)CC#N)=C4C(CN(C5=CC=CC6=C5C(Cl)=CC=C6)CC4)=N2)=O |
| Purity: | 99.84 |
| Description: | MRTX849 acid, a derivative of MRTX849, can be used in the synthesis of PROTAC LC-2 (HY-137516). LC-2 is a potent and first-in-class PROTAC capable of degrading endogenous KRAS G12C (DC50s between 0.25 and 0.76 ?M)[1][2]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
