N-Epsilon-propargyloxycarbonyl-L-lysine [CAS 1215204-46-8]
Partner: MedChemexpress LLC
| CAS No: | 1215204-46-8 |
| Applications: | Cancer-programmed cell death |
| MW: | 228.25 |
| Formula: | C10H16N2O4 |
| SMILES: | N[C@@H](CCCCNC(OCC#C)=O)C(O)=O |
| Purity: | 98.0 |
| Description: | N-?-propargyloxycarbonyl-L-lysine (H-L-Lys(Poc)-OH) is a lysine-based unnatural amino acid (UAA). N-?-propargyloxycarbonyl-L-lysine is widely used for bio-conjugation of fluorescent probes in diverse organisms from E. coli to mammalian cells even in animals[1][2]. N-?-propargyloxycarbonyl-L-lysine is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
