5'-O-DMT-N4-Bz-2'-F-dC [CAS 146954-77-0] (10mM in DMSO)
Partner: MedChemexpress LLC
| CAS No: | 146954-77-0 |
| Applications: | COVID-19-anti-virus |
| MW: | 651.68 |
| Formula: | C37H34FN3O7 |
| SMILES: | O[C@@H]([C@@H](F)[C@H](N1C(N=C(NC(C2=CC=CC=C2)=O)C=C1)=O)O3)[C@H]3COC(C4=CC=CC=C4)(C5=CC=C(OC)C=C5)C6=CC=C(OC)C=C6 |
| Purity: | 99.85 |
| Description: | 5'-O-DMT-N4-Bz-2'-F-dC is a nucleoside with protective and modification effects. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
