5'-O-DMT-N4-Ac-2'-F-dC [CAS 159414-98-9] (10mM in DMSO)
Partner: MedChemexpress LLC
| CAS No: | 159414-98-9 |
| Applications: | COVID-19-anti-virus |
| MW: | 589.61 |
| Formula: | C32H32FN3O7 |
| SMILES: | COC(C=C1)=CC=C1C(C2=CC=CC=C2)(C3=CC=C(OC)C=C3)OC[C@@H]4[C@@H](O)[C@@H](F)[C@H](N5C(N=C(NC(C)=O)C=C5)=O)O4 |
| Purity: | 99.11 |
| Description: | 5'-O-DMT-N4-Ac-2'-F-dC is a modified nucleoside and can be used to synthesize DNA or RNA. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
