Mycophenolic acid glucuronide [CAS 31528-44-6]
Partner: MedChemexpress LLC
| CAS No: | 31528-44-6 |
| Applications: | Cancer-programmed cell death |
| MW: | 496.46 |
| Formula: | C23H28O12 |
| SMILES: | C/C(CCC(O)=O)=C\CC(C(O[C@@H]([C@@H]([C@H]1O)O)O[C@@H]([C@H]1O)C(O)=O)=C(C2=O)C(CO2)=C3C)=C3OC |
| Purity: | 98.65 |
| Description: | Mycophenolic acid glucuronide is a metabolite of the immunosuppressant mycophenolic acid (MPA). Mycophenolic acid glucuronide shows anti-tumor activity and can be used in adenocarcinoma research[1][2][3]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
