BRD0539 [CAS 1403838-79-8]
Partner: MedChemexpress LLC
| CAS No: | 1403838-79-8 |
| Applications: | COVID-19-anti-virus |
| MW: | 452.54 |
| Formula: | C25H25FN2O3S |
| SMILES: | OC[C@@H]1NC2=C(C=C(C3=CC=CC=C3F)C=C2)[C@@]4([H])[C@]1([H])CCN4S(=O)(C5=CC=C(C)C=C5)=O |
| Purity: | 98.03 |
| Description: | BRD0539 is a cell-permeable and non-toxic inhibitor of CRISPR-Cas9. BRD0539 inhibits Streptococcus pyogenes Cas9 (SpCas9) (apparent IC50=22 ?M) in an in vitro DNA cleavage assay[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
