Dot1L-IN-4 [CAS 2565705-02-2]
Partner: MedChemexpress LLC
| CAS No: | 2565705-02-2 |
| Applications: | Cancer-programmed cell death |
| MW: | 661.08 |
| Formula: | C28H27ClF2N8O5S |
| SMILES: | O=S(C1=CC=C(N[C@H](C2=NC=CC=C2Cl)C3=C4OC(F)(F)OC4=CC=C3)C(NC5=NC(OC)=NC(N6CCNCC6)=N5)=C1)(C)=O |
| Purity: | 99.60 |
| Description: | Dot1L-IN-4 is a potent disruptor of telomeric silencing 1-like protein (DOT1L) inhibitor with an IC50 SPA DOT1L of 0.11 nM[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
